EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O7 |
| Net Charge | 0 |
| Average Mass | 282.248 |
| Monoisotopic Mass | 282.07395 |
| SMILES | COc1ccc(/C=C/C(=O)OCC(O)C(=O)O)cc1O |
| InChI | InChI=1S/C13H14O7/c1-19-11-4-2-8(6-9(11)14)3-5-12(16)20-7-10(15)13(17)18/h2-6,10,14-15H,7H2,1H3,(H,17,18)/b5-3+ |
| InChIKey | ZWAYKTOAUPIGML-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxypropanoic acid (CHEBI:190887) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxypropanoic acid |