EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO2 |
| Net Charge | 0 |
| Average Mass | 115.132 |
| Monoisotopic Mass | 115.06333 |
| SMILES | NC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C5H9NO2/c6-5(4(7)8)2-1-3-5/h1-3,6H2,(H,7,8) |
| InChIKey | FVTVMQPGKVHSEY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-AMINOCYCLOBUTANE CARBOXYLIC ACID (CHEBI:190867) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| 1-aminocyclobutane-1-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:22264-50-2 | ChemIDplus |