EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O6 |
| Net Charge | 0 |
| Average Mass | 372.417 |
| Monoisotopic Mass | 372.15729 |
| SMILES | COc1cccc(CCC(=O)C(O)C(=O)CCc2ccc(O)c(OC)c2)c1 |
| InChI | InChI=1S/C21H24O6/c1-26-16-5-3-4-14(12-16)7-10-18(23)21(25)19(24)11-8-15-6-9-17(22)20(13-15)27-2/h3-6,9,12-13,21-22,25H,7-8,10-11H2,1-2H3 |
| InChIKey | OZIRNHWOGPNIHV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxyphenyl)heptane-3,5-dione (CHEBI:190834) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxyphenyl)heptane-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 74853371 | ChemSpider |
| HMDB0133537 | HMDB |