EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9O4S |
| Net Charge | -1 |
| Average Mass | 273.289 |
| Monoisotopic Mass | 273.02270 |
| SMILES | O=S(=O)([O-])Oc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C14H10O4S/c15-19(16,17)18-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,(H,15,16,17)/p-1 |
| InChIKey | KSLTXOSGWUKDQR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-phenanthryl sulfate (CHEBI:19083) is a phenanthryl monosulfate (CHEBI:25964) |
| 1-phenanthryl sulfate (CHEBI:19083) is conjugate base of 1-phenanthryl hydrogen sulfate (CHEBI:37456) |
| Incoming Relation(s) |
| 1-phenanthryl hydrogen sulfate (CHEBI:37456) is conjugate acid of 1-phenanthryl sulfate (CHEBI:19083) |
| IUPAC Name |
|---|
| 1-phenanthryl sulfate |
| Synonym | Source |
|---|---|
| 1-phenanthrylsulfate | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0535 | UM-BBD |