EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3c2ccc2ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20O6/c21-10-16-17(22)18(23)19(24)20(26-16)25-15-7-3-6-13-12-5-2-1-4-11(12)8-9-14(13)15/h1-9,16-24H,10H2/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | RYTFSXYZAYHCOC-OUUBHVDSSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-phenanthryl β-D-glucoside (CHEBI:19082) has functional parent 1-phenanthrol (CHEBI:27528) |
| 1-phenanthryl β-D-glucoside (CHEBI:19082) is a phenanthryl β-D-glucopyranoside (CHEBI:25963) |
| IUPAC Name |
|---|
| phenanthren-1-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 1-Phenanthryl-beta-D-glucopyranoside | UM-BBD |