EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O8 |
| Net Charge | 0 |
| Average Mass | 350.323 |
| Monoisotopic Mass | 350.10017 |
| SMILES | COc1cc(/C=C/C(=O)OC2CC(C(=O)O)=CC(O)C2O)ccc1O |
| InChI | InChI=1S/C17H18O8/c1-24-13-6-9(2-4-11(13)18)3-5-15(20)25-14-8-10(17(22)23)7-12(19)16(14)21/h2-7,12,14,16,18-19,21H,8H2,1H3,(H,22,23)/b5-3+ |
| InChIKey | VBJWKEXLVPKYAA-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohex-1-ene-1-carboxylic acid (CHEBI:190758) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-5-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxycyclohexene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0130157 | HMDB |