EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O9 |
| Net Charge | 0 |
| Average Mass | 342.300 |
| Monoisotopic Mass | 342.09508 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C15H18O9/c16-8-3-1-7(5-9(8)17)2-4-11(18)23-6-10-12(19)13(20)14(21)15(22)24-10/h1-5,10,12-17,19-22H,6H2/b4-2+ |
| InChIKey | JVVFTHAOTNXPOZ-DUXPYHPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | root (BTO:0001188) | MetaboLights (MTBLS4362) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3,4,5,6-tetrahydroxyoxan-2-yl)methyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CHEBI:190752) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (3,4,5,6-tetrahydroxyoxan-2-yl)methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0125114 | HMDB |