EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O6 |
| Net Charge | 0 |
| Average Mass | 312.277 |
| Monoisotopic Mass | 312.06339 |
| SMILES | [H][C@]12OCC[C@@]1([H])c1c(cc(O)c3c(=O)c4c(O)cccc4oc13)O2 |
| InChI | InChI=1S/C17H12O6/c18-8-2-1-3-10-13(8)15(20)14-9(19)6-11-12(16(14)22-10)7-4-5-21-17(7)23-11/h1-3,6-7,17-19H,4-5H2/t7-,17+/m0/s1 |
| InChIKey | WUSMTEDKVPWFDN-BWKAKNAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oreochromis niloticus (ncbitaxon:8128) | serum (BTO:0001239) | MetaboLights (MTBLS4262) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrodemethylsterigmatocystin (CHEBI:190744) has role Aspergillus metabolite (CHEBI:76956) |
| dihydrodemethylsterigmatocystin (CHEBI:190744) is a sterigmatocystins (CHEBI:26759) |
| Incoming Relation(s) |
| sterigmatocystin (CHEBI:18227) has functional parent dihydrodemethylsterigmatocystin (CHEBI:190744) |
| IUPAC Name |
|---|
| (3aR,12cS)-6,8-dihydroxy-1,2,3a,12c-tetrahydro-7H-furo[3',2':4,5]furo[2,3-c]xanthen-7-one |
| Synonyms | Source |
|---|---|
| (3S,7R)-11,15-dihydroxy-6,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(12),2(9),10,14,16,18-hexaen-13-one | IUPAC |
| DHDMST | KEGG COMPOUND |
| demethyldihydrosterigmatocystin | ChEBI |
| (3aR,12cS)-1,2,3a,12c-tetrahydro-6,8-dihydroxy-7H-furo[3',2':4,5]furo[2,3-c]xanthen-7-one | ChEBI |
| UniProt Name | Source |
|---|---|
| dihydro-6-demethylsterigmatocystin | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:30517-66-9 | ChemIDplus |
| Citations |
|---|