EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O2 |
| Net Charge | 0 |
| Average Mass | 172.183 |
| Monoisotopic Mass | 172.05243 |
| SMILES | O=C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13) |
| InChIKey | LNETULKMXZVUST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthoic acid (CHEBI:36466) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1-naphthoic acid (CHEBI:36466) has role fungal xenobiotic metabolite (CHEBI:76968) |
| 1-naphthoic acid (CHEBI:36466) is a naphthoic acid (CHEBI:25483) |
| 1-naphthoic acid (CHEBI:36466) is conjugate acid of 1-naphthoate (CHEBI:36298) |
| Incoming Relation(s) |
| 1-naphthoate (CHEBI:36298) is conjugate base of 1-naphthoic acid (CHEBI:36466) |
| 1-naphthoyl group (CHEBI:52676) is substituent group from 1-naphthoic acid (CHEBI:36466) |
| IUPAC Name |
|---|
| naphthalene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-Carboxynaphthalene | KEGG COMPOUND |
| 1-naphthalenecarboxylic acid | NIST Chemistry WebBook |
| 1-Naphthoic acid | KEGG COMPOUND |
| alpha-Naphthoic acid | KEGG COMPOUND |
| α-naphthoic acid | NIST Chemistry WebBook |
| Citations |
|---|