EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21NO10S3 |
| Net Charge | 0 |
| Average Mass | 435.498 |
| Monoisotopic Mass | 435.03276 |
| SMILES | CS(=O)/C=C/CC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C12H21NO10S3/c1-25(18)5-3-2-4-8(13-23-26(19,20)21)24-12-11(17)10(16)9(15)7(6-14)22-12/h3,5,7,9-12,14-17H,2,4,6H2,1H3,(H,19,20,21)/b5-3+,13-8+ |
| InChIKey | ZFLXCZJBYSPSKU-WOXYBUCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oreochromis niloticus (ncbitaxon:8128) | serum (BTO:0001239) | MetaboLights (MTBLS4262) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(Methylsulfinyl)but-3-enylglucosinolate (CHEBI:190725) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (E,1E)-5-methylsulinyl-N-sulooxypent-4-enimidothioate |