EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO10S2 |
| Net Charge | 0 |
| Average Mass | 389.404 |
| Monoisotopic Mass | 389.04504 |
| SMILES | C=C[C@@H](O)C/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/b12-7-/t5-,6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | MYHSVHWQEVDFQT-KBHNZSCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oreochromis niloticus (ncbitaxon:8128) | serum (BTO:0001239) | MetaboLights (MTBLS4262) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-Hydroxybut-3-enylglucosinolate (CHEBI:190717) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z,3S)-3-hydroxy-N-sulooxypent-4-enimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 24608073 | ChemSpider |