EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@H](O)C[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-15,17,21H,3-8,10H2,1-2H3/t13-,14-,15+,17+,18-,19-/m0/s1 |
| InChIKey | WSCUHXPGYUMQEX-GBHAUCNQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oreochromis niloticus (ncbitaxon:8128) | serum (BTO:0001239) | MetaboLights (MTBLS4262) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11b-Hydroxyandrost-4-ene-3,17-dione (CHEBI:190716) has role androgen (CHEBI:50113) |
| 11b-Hydroxyandrost-4-ene-3,17-dione (CHEBI:190716) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (8S,9S,10R,11R,13S,14S)-11-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| Manual Xrefs | Databases |
|---|---|
| 5442265 | ChemSpider |
| C05284 | KEGG COMPOUND |
| LMST02020066 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:564-33-0 | ChemIDplus |