EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O3S |
| Net Charge | 0 |
| Average Mass | 296.392 |
| Monoisotopic Mass | 296.11946 |
| SMILES | CSCC[C@H](NC(=O)[C@@H]([NH3+])Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C14H20N2O3S/c1-20-8-7-12(14(18)19)16-13(17)11(15)9-10-5-3-2-4-6-10/h2-6,11-12H,7-9,15H2,1H3,(H,16,17)(H,18,19)/t11-,12-/m0/s1 |
| InChIKey | PYOHODCEOHCZBM-RYUDHWBXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Met zwitterion (CHEBI:190709) is a dipeptide zwitterion (CHEBI:90799) |
| Phe-Met zwitterion (CHEBI:190709) is tautomer of Phe-Met (CHEBI:74719) |
| Incoming Relation(s) |
| Phe-Met (CHEBI:74719) is tautomer of Phe-Met zwitterion (CHEBI:190709) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-azaniumyl-3-phenylpropanoyl]amino}-4-(methylsulfanyl)butanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-[(2S)-2-ammonio-3-phenylpropanamido]-4-(methylsulfanyl)butanoate | ChEBI |
| FM zwitterion | ChEBI |
| L-phenylalanyl-L-methionine zwitterion | ChEBI |
| L-Phe-L-Met zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-phenylalanyl-L-methionine | UniProt |