EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3O |
| Net Charge | 0 |
| Average Mass | 283.375 |
| Monoisotopic Mass | 283.16846 |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O/c1-3-20(4-2)16-12-10-15(11-13-16)19-17(21)18-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3,(H2,18,19,21) |
| InChIKey | NGGRXCCACIAMPB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-(diethylamino)phenyl]-N'-phenylurea (CHEBI:190671) is a dialkylarylamine (CHEBI:23665) |
| N-[4-(diethylamino)phenyl]-N'-phenylurea (CHEBI:190671) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1-[4-(diethylamino)phenyl]-3-phenylurea |
| Manual Xrefs | Databases |
|---|---|
| 639803 | ChemSpider |