EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO2 |
| Net Charge | 0 |
| Average Mass | 207.273 |
| Monoisotopic Mass | 207.12593 |
| SMILES | OC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C12H17NO2/c14-12(11-4-2-1-3-5-11)10-13-6-8-15-9-7-13/h1-5,12,14H,6-10H2 |
| InChIKey | CKCUWHAMJDWXOH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-morpholino-1-phenyl-1-ethanol (CHEBI:190664) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-morpholin-4-yl-1-phenylethanol |