EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2S |
| Net Charge | 0 |
| Average Mass | 236.296 |
| Monoisotopic Mass | 236.06195 |
| SMILES | CCOC(=O)c1sc(-n2cccc2)nc1C |
| InChI | InChI=1S/C11H12N2O2S/c1-3-15-10(14)9-8(2)12-11(16-9)13-6-4-5-7-13/h4-7H,3H2,1-2H3 |
| InChIKey | WZMFHZGFBDLDTG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 4-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-5-carboxylate (CHEBI:190645) is a aromatic carboxylic acid (CHEBI:33859) |
| ethyl 4-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-5-carboxylate (CHEBI:190645) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| ethyl 4-methyl-2-pyrrol-1-yl-1,3-thiazole-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2025790 | ChemSpider |