EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16D3NO4 |
| Net Charge | 0 |
| Average Mass | 304.360 |
| Monoisotopic Mass | 304.15024 |
| SMILES | [H][C@]12Cc3ccc(OC([2H])([2H])[2H])c4c3[C@]3(CCN1)[C@@]2(O)CCC(=O)[C@]3([H])O4 |
| InChI | InChI=1S/C17H19NO4/c1-21-11-3-2-9-8-12-17(20)5-4-10(19)15-16(17,6-7-18-12)13(9)14(11)22-15/h2-3,12,15,18,20H,4-8H2,1H3/t12-,15+,16+,17-/m1/s1/i1D3 |
| InChIKey | RIKMCJUNPCRFMW-ZXTOONLTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Noroxycodone-d3 (CHEBI:190614) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4R,4aS,7aR,12bS)-4a-hydroxy-9-(trideuteriomethoxy)-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinolin-7-one |
| Manual Xrefs | Databases |
|---|---|
| 48062369 | ChemSpider |