EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13N |
| Net Charge | 0 |
| Average Mass | 243.309 |
| Monoisotopic Mass | 243.10480 |
| SMILES | c1ccc2c(c1)-c1ccccc1C2c1ccncc1 |
| InChI | InChI=1S/C18H13N/c1-3-7-16-14(5-1)15-6-2-4-8-17(15)18(16)13-9-11-19-12-10-13/h1-12,18H |
| InChIKey | QZQYNZZUBLVQAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(9H-fluoren-9-yl)pyridine (CHEBI:190561) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 4-(9H-luoren-9-yl)pyridine |
| Manual Xrefs | Databases |
|---|---|
| 2027758 | ChemSpider |