EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N3O4 |
| Net Charge | 0 |
| Average Mass | 373.453 |
| Monoisotopic Mass | 373.20016 |
| SMILES | CC(C)(C)C(NC(=O)c1cn(CCCCC(=O)O)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C20H27N3O4/c1-20(2,3)17(18(21)26)22-19(27)14-12-23(11-7-6-10-16(24)25)15-9-5-4-8-13(14)15/h4-5,8-9,12,17H,6-7,10-11H2,1-3H3,(H2,21,26)(H,22,27)(H,24,25) |
| InChIKey | YFFKBKQHLMKTJY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADBICA N-pentanoic acid metabolite (CHEBI:190553) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 5-[3-[(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamoyl]indol-1-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29763747 | ChemSpider |