EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O4 |
| Net Charge | 0 |
| Average Mass | 262.265 |
| Monoisotopic Mass | 262.09536 |
| SMILES | CC(=O)NC(=Cc1ccc(NC(C)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H14N2O4/c1-8(16)14-11-5-3-10(4-6-11)7-12(13(18)19)15-9(2)17/h3-7H,1-2H3,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | BQKAQRBTGRQBQA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(acetylamino)-3-[4-(acetylamino)phenyl]acrylic acid (CHEBI:190539) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-acetamido-3-(4-acetamidophenyl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2028637 | ChemSpider |