EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO4 |
| Net Charge | 0 |
| Average Mass | 329.396 |
| Monoisotopic Mass | 329.16271 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CC=C)[C@]([H])(C4)[C@]3(O)CC[C@@H]2O |
| InChI | InChI=1S/C19H23NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,13-14,17,21-23H,1,5-10H2/t13-,14+,17-,18-,19+/m0/s1 |
| InChIKey | HMWHERQFMBEHNG-AQQQZIQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | liver (BTO:0000759) | MetaboLights (MTBLS4163) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Alpha Naloxol (CHEBI:190533) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4R,4aS,7S,7aR,12bS)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinoline-4a,7,9-triol |
| Manual Xrefs | Databases |
|---|---|
| 4590928 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:20410-95-1 | ChemIDplus |