EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O9 |
| Net Charge | 0 |
| Average Mass | 520.619 |
| Monoisotopic Mass | 520.26723 |
| SMILES | [H][C@]12C[C@]([H])(OC(C)=O)C(C)=C([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(C)CC[C@H](OC(C)=O)C(=C)[C@@]3([H])[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C28H40O9/c1-13-20(34-15(3)29)10-11-28(9)22(13)24(33)19-12-21(35-16(4)30)14(2)23(27(19,7)8)25(36-17(5)31)26(28)37-18(6)32/h19-22,24-26,33H,1,10-12H2,2-9H3/t19-,20-,21-,22-,24+,25+,26-,28+/m0/s1 |
| InChIKey | SCJZVZRWMAAWIK-IMWBZJKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudotaxus chienii (ncbitaxon:89481) | - | PubMed (33622251) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-hydroxytaxusin (CHEBI:190505) has functional parent taxusin (CHEBI:63664) |
| 2α-hydroxytaxusin (CHEBI:190505) has role plant metabolite (CHEBI:76924) |
| 2α-hydroxytaxusin (CHEBI:190505) is a acetate ester (CHEBI:47622) |
| 2α-hydroxytaxusin (CHEBI:190505) is a carbotricyclic compound (CHEBI:38032) |
| 2α-hydroxytaxusin (CHEBI:190505) is a secondary alcohol (CHEBI:35681) |
| 2α-hydroxytaxusin (CHEBI:190505) is a taxane diterpenoid (CHEBI:50367) |
| IUPAC Name |
|---|
| 2-hydroxy-2α,5α,9α,10β,13α-taxa-4(20),11-diene-5,9,10,13-tetrayl tetraacetate |
| UniProt Name | Source |
|---|---|
| 2α-hydroxytaxusin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14478 | MetaCyc |
| Citations |
|---|