EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190441 - barium acetate
| Formula | Ba.2C2H3O2 |
| Net Charge | 0 |
| Average Mass | 255.416 |
| Monoisotopic Mass | 255.93186 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C2H4O2.Ba/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | ITHZDDVSAWDQPZ-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| Biological Role: | nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Application: | mordant Substance used to set dyes on fabrics or tissue sections by forming a coordination complex with the dye which then attaches to the fabric or tissue. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| barium acetate (CHEBI:190441) has role catalyst (CHEBI:35223) |
| barium acetate (CHEBI:190441) has role mordant (CHEBI:74152) |
| barium acetate (CHEBI:190441) is a acetate salt (CHEBI:59230) |
| barium acetate (CHEBI:190441) is a organic barium salt (CHEBI:190442) |
| IUPAC Name |
|---|
| barium diacetate |
| Synonyms | Source |
|---|---|
| acetic acid barium salt | NIST Chemistry WebBook |
| acetic acid, barium salt (2:1) | ChemIDplus |
| barium(II) acetate | ChEBI |
| acetic acid, barium salt | NIST Chemistry WebBook |
| barium di(acetate) | ChemIDplus |
| barium(2+) diacetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Barium_acetate | Wikipedia |
| 10515 | ChemSpider |
| Citations |
|---|