EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O9 |
| Net Charge | 0 |
| Average Mass | 464.511 |
| Monoisotopic Mass | 464.20463 |
| SMILES | C[C@]12CCC3c4ccc(O)cc4CCC3C1CC(OC1OC(C(=O)O)C(O)C(O)C1O)C2O |
| InChI | InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(25)8-10(12)2-4-14(13)15(24)9-16(21(24)29)32-23-19(28)17(26)18(27)20(33-23)22(30)31/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/t13?,14?,15?,16?,17?,18?,19?,20?,21?,23?,24-/m0/s1 |
| InChIKey | FQYGGFDZJFIDPU-CBXPMNRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | MetaboLights (MTBLS4522) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Estriol-16-Glucuronide (CHEBI:190411) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| 6-[[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |