EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41NO2.HCl |
| Net Charge | 0 |
| Average Mass | 424.069 |
| Monoisotopic Mass | 423.29041 |
| SMILES | Cl.[H][C@@]12CC=C3C[C@@H](OCCN(CC)CC)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H41NO2.ClH/c1-5-26(6-2)15-16-28-19-11-13-24(3)18(17-19)7-8-20-21-9-10-23(27)25(21,4)14-12-22(20)24;/h7,19-22H,5-6,8-17H2,1-4H3;1H/t19-,20-,21-,22-,24-,25-;/m0./s1 |
| InChIKey | GZFYZYBWLCYBMI-MYZJJQSMSA-N |
| Roles Classification |
|---|
| Biological Roles: | sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antiviral agent A substance that destroys or inhibits replication of viruses. Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Application: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has part 3β-(2-diethylaminoethoxy)androst-5-en-17-one(1+) (CHEBI:190403) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role antiviral agent (CHEBI:22587) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role nicotinic antagonist (CHEBI:48878) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3β-[2-(diethylamino)ethoxy]androst-5-en-17-one hydrochloride |
| Synonyms | Source |
|---|---|
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one HCl | ChEBI |
| (3β)-3-[2-(diethylamino)ethoxy]androst-5-en-17-one hydrochloride | ChEBI |
| N,N-diethyl-2-[(17-oxoandrost-5-en-3β-yl)oxy]ethanaminium chloride | IUPAC |
| U 18,666A | ChemIDplus |
| U 18666A | ChemIDplus |
| U-18,666A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 8129692 | ChemSpider |
| WO2010083445 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:3039-71-2 | ChemIDplus |
| Citations |
|---|