EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41NO2.HCl |
| Net Charge | 0 |
| Average Mass | 424.069 |
| Monoisotopic Mass | 423.29041 |
| SMILES | Cl.[H][C@@]12CC=C3C[C@@H](OCCN(CC)CC)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H41NO2.ClH/c1-5-26(6-2)15-16-28-19-11-13-24(3)18(17-19)7-8-20-21-9-10-23(27)25(21,4)14-12-22(20)24;/h7,19-22H,5-6,8-17H2,1-4H3;1H/t19-,20-,21-,22-,24-,25-;/m0./s1 |
| InChIKey | GZFYZYBWLCYBMI-MYZJJQSMSA-N |
| Roles Classification |
|---|
| Biological Roles: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has part 3β-(2-diethylaminoethoxy)androst-5-en-17-one(1+) (CHEBI:190403) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role antiviral agent (CHEBI:22587) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role nicotinic antagonist (CHEBI:48878) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one hydrochloride (CHEBI:190404) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3β-[2-(diethylamino)ethoxy]androst-5-en-17-one hydrochloride |
| Synonyms | Source |
|---|---|
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one HCl | ChEBI |
| (3β)-3-[2-(diethylamino)ethoxy]androst-5-en-17-one hydrochloride | ChEBI |
| N,N-diethyl-2-[(17-oxoandrost-5-en-3β-yl)oxy]ethanaminium chloride | IUPAC |
| U 18,666A | ChemIDplus |
| U 18666A | ChemIDplus |
| U-18,666A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 8129692 | ChemSpider |
| WO2010083445 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:3039-71-2 | ChemIDplus |
| Citations |
|---|