EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41NO2 |
| Net Charge | 0 |
| Average Mass | 387.608 |
| Monoisotopic Mass | 387.31373 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OCCN(CC)CC)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H41NO2/c1-5-26(6-2)15-16-28-19-11-13-24(3)18(17-19)7-8-20-21-9-10-23(27)25(21,4)14-12-22(20)24/h7,19-22H,5-6,8-17H2,1-4H3/t19-,20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | DMZCCFMMPHJWQY-BKWLFHPQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.3.1.72 (Delta(24)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ24-sterol reductase (EC 1.3.1.72). nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. sterol biosynthesis inhibitor Any compound that inhibits the biosynthesis of any sterol. |
| Application: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) has role EC 1.3.1.72 (Δ24-sterol reductase) inhibitor (CHEBI:78728) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) has role nicotinic antagonist (CHEBI:48878) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) has role sterol biosynthesis inhibitor (CHEBI:83317) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) is a 17-oxo steroid (CHEBI:19168) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) is a ether (CHEBI:25698) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) is a tertiary amino compound (CHEBI:50996) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) is conjugate base of 3β-(2-diethylaminoethoxy)androst-5-en-17-one(1+) (CHEBI:190403) |
| Incoming Relation(s) |
| 3β-(2-diethylaminoethoxy)androst-5-en-17-one(1+) (CHEBI:190403) is conjugate acid of 3β-(2-diethylaminoethoxy)androst-5-en-17-one (CHEBI:190402) |
| IUPAC Name |
|---|
| 3β-[2-(diethylamino)ethoxy]androst-5-en-17-one |
| Synonyms | Source |
|---|---|
| 3β-(2-(diethylamino)ethoxy)androst-5-en-17-one | ChemIDplus |
| U-18666A (free base) | ChEBI |
| U18666A (free base) | ChEBI |
| Citations |
|---|