EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N4O8P2S |
| Net Charge | +1 |
| Average Mass | 483.400 |
| Monoisotopic Mass | 483.08628 |
| SMILES | CCC(O)c1sc(CCOP(=O)(O)OP(=O)(O)O)c(C)[n+]1Cc1cnc(C)nc1N |
| InChI | InChI=1S/C15H24N4O8P2S/c1-4-12(20)15-19(8-11-7-17-10(3)18-14(11)16)9(2)13(30-15)5-6-26-29(24,25)27-28(21,22)23/h7,12,20H,4-6,8H2,1-3H3,(H4-,16,17,18,21,22,23,24,25)/p+1 |
| InChIKey | JICPENPXPGFLJB-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS3854) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(alpha-Hydroxypropyl)thiamine diphosphate (CHEBI:190398) is a thiamine phosphate (CHEBI:26945) |
| IUPAC Name |
|---|
| 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(1-hydroxypropyl)-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| C21017 | KEGG COMPOUND |