EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16O9 |
| Net Charge | 0 |
| Average Mass | 340.284 |
| Monoisotopic Mass | 340.07943 |
| SMILES | COc1cc(/C=C/C(=O)OC(CC(=O)O)C(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C15H16O9/c1-22-9-5-8(6-10(23-2)14(9)19)3-4-13(18)24-11(15(20)21)7-12(16)17/h3-6,11,19H,7H2,1-2H3,(H,16,17)(H,20,21)/b4-3+ |
| InChIKey | DUDGAPSRYCQPBG-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS3854) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinapoyl malate (CHEBI:190397) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxybutanedioic acid |