EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O8 |
| Net Charge | 0 |
| Average Mass | 326.301 |
| Monoisotopic Mass | 326.10017 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H18O8/c16-7-11(19)13(21)15(23)14(22)12(20)10(18)6-3-8-1-4-9(17)5-2-8/h1-6,11,13-17,19,21-23H,7H2/b6-3+/t11-,13-,14+,15+/m1/s1 |
| InChIKey | MBXDFASBTUWDHK-MFFVXOFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS3854) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-Coumaroyl-D-glucose (CHEBI:190396) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E,5R,6S,7R,8R)-5,6,7,8,9-pentahydroxy-1-(4-hydroxyphenyl)non-1-ene-3,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 19799830 | ChemSpider |