EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O4 |
| Net Charge | 0 |
| Average Mass | 418.618 |
| Monoisotopic Mass | 418.30831 |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C26H42O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-30-26(28)20-18-23-17-19-24(27)25(22-23)29-2/h17-20,22,27H,3-16,21H2,1-2H3/b20-18+ |
| InChIKey | ZISDTRGMDDVTKY-CZIZESTLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hexadecyl ferulate (CHEBI:190388) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| hexadecyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4944397 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:64190-80-3 | ChemIDplus |