EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190385 - 13,14-dihydroxy-octadecanoic acid
| Formula | C18H36O4 |
| Net Charge | 0 |
| Average Mass | 316.482 |
| Monoisotopic Mass | 316.26136 |
| SMILES | CCCCC(O)C(O)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O4/c1-2-3-13-16(19)17(20)14-11-9-7-5-4-6-8-10-12-15-18(21)22/h16-17,19-20H,2-15H2,1H3,(H,21,22) |
| InChIKey | SXFPGQOZGWIINB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydroxy-octadecanoic acid (CHEBI:190385) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 13,14-dihydroxyoctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 14063031 | ChemSpider |
| LMFA01050552 | LIPID MAPS |