EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO5 |
| Net Charge | 0 |
| Average Mass | 225.200 |
| Monoisotopic Mass | 225.06372 |
| SMILES | COc1ccc(C(=O)NCC(=O)O)cc1O |
| InChI | InChI=1S/C10H11NO5/c1-16-8-3-2-6(4-7(8)12)10(15)11-5-9(13)14/h2-4,12H,5H2,1H3,(H,11,15)(H,13,14) |
| InChIKey | HOZJFFMWTLPBCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(3-hydroxy-4-methoxyphenyl)methylidene]amino}acetic acid (CHEBI:190374) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(3-hydroxy-4-methoxybenzoyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 36087075 | ChemSpider |
| HMDB0140926 | HMDB |