EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O3 |
| Net Charge | 0 |
| Average Mass | 290.403 |
| Monoisotopic Mass | 290.18819 |
| SMILES | C=CCCCC#CC#CCC(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h2,17,19H,1,3-5,9-10,12-16H2,(H,20,21) |
| InChIKey | MKFHJJAOYAVQNC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxy-17-octadecene-10,12-diynoic acid (CHEBI:190368) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 8-hydroxyoctadec-17-en-10,12-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472266 | ChemSpider |
| LMFA01050292 | LIPID MAPS |