EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O2 |
| Net Charge | 0 |
| Average Mass | 275.352 |
| Monoisotopic Mass | 275.16338 |
| SMILES | COc1cc(NC(C)CCCN)c2ncccc2c1O |
| InChI | InChI=1S/C15H21N3O2/c1-10(5-3-7-16)18-12-9-13(20-2)15(19)11-6-4-8-17-14(11)12/h4,6,8-10,18-19H,3,5,7,16H2,1-2H3 |
| InChIKey | DCIFAKQLYKKQAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxyprimaquine (CHEBI:190367) is a aminoquinoline (CHEBI:36709) |
| IUPAC Name |
|---|
| 8-(5-aminopentan-2-ylamino)-6-methoxyquinolin-5-ol |
| Manual Xrefs | Databases |
|---|---|
| 19991192 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:57695-07-5 | ChemIDplus |