EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O2 |
| Net Charge | 0 |
| Average Mass | 252.398 |
| Monoisotopic Mass | 252.20893 |
| SMILES | CCCCC/C=C/C/C=C/CCCCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h6-7,9-10H,2-5,8,11-15H2,1H3,(H,17,18)/b7-6+,10-9+ |
| InChIKey | WPJGPAAPSBVXNU-AVQMFFATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,10-hexadecadienoic acid (CHEBI:190359) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (7E,10E)-hexadeca-7,10-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11553552 | ChemSpider |
| LMFA01030806 | LIPID MAPS |