EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O4 |
| Net Charge | 0 |
| Average Mass | 380.569 |
| Monoisotopic Mass | 380.29266 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)C(O)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C23H40O4/c1-13(20(27)12-24)16-4-5-17-21-18(7-9-23(16,17)3)22(2)8-6-15(25)10-14(22)11-19(21)26/h13-21,24-27H,4-12H2,1-3H3/t13-,14-,15+,16+,17-,18-,19+,20?,21-,22-,23+/m0/s1 |
| InChIKey | ASYNKIUHLPMXKX-USBDYWLPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-Nor-5beta-cholane-3alpha,7alpha,22,23-tetrol (CHEBI:190357) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3R,5S,7R,8R,9S,10S,13R,14S,17R)-17-[(2S)-3,4-dihydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 4447388 | ChemSpider |
| LMST04060004 | LIPID MAPS |