EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(CCC(=O)O)c(O)cc1O |
| InChI | InChI=1S/C10H12O5/c1-15-9-4-6(2-3-10(13)14)7(11)5-8(9)12/h4-5,11-12H,2-3H2,1H3,(H,13,14) |
| InChIKey | PLLIJHAKLDZNQC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2,4-dihydroxy-5-methoxyphenyl)propanoic acid (CHEBI:190355) is a benzenes (CHEBI:22712) |
| 3-(2,4-dihydroxy-5-methoxyphenyl)propanoic acid (CHEBI:190355) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxy-5-methoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 62818848 | ChemSpider |
| HMDB0125520 | HMDB |