EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C=C(CCC=C(C)C)C1CCC=C(CCC=C(C)C)C1 |
| InChI | InChI=1S/C20H32/c1-16(2)9-6-11-18(5)20-14-8-13-19(15-20)12-7-10-17(3)4/h9-10,13,20H,5-8,11-12,14-15H2,1-4H3 |
| InChIKey | OIRFZVJHADZVMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6J |
| Sideritis scardica (ncbitaxon:155261) | - | PubMed (23495164) | |
| Glandora rosmarinifolia (ncbitaxon:475898) | - | DOI (10.1371/journal.pone.0196947) | |
| Humulus lupulus (ncbitaxon:3486) | - | Article (Lammens, H. et al, Bull. Soc. Chim. Belg., 1968, 77, 497) | |
| Boswellia socotrana (ncbitaxon:208721) | bark (BTO:0001301) | DOI (10.1016/j.foodchem.2010.11.150) | |
| Pinus halepensis (ncbitaxon:71633) | - | DOI (10.1016/s2222-1808(14)60323-6) |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-camphorene (CHEBI:190332) has role volatile oil component (CHEBI:27311) |
| γ-camphorene (CHEBI:190332) is a cycloalkene (CHEBI:33643) |
| γ-camphorene (CHEBI:190332) is a diterpene (CHEBI:35190) |
| IUPAC Name |
|---|
| 5-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-en-1-yl)cyclohexene |
| Synonyms | Source |
|---|---|
| 5-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-enyl)cyclohexene | IUPAC |
| γ-camphorene | KNApSAcK |
| 5-(6-methylhepta-1,5-dien-2-yl)-1-(4-methylpent-3-en-1-yl)cyclohex-1-ene | IUPAC |
| meta-camphorene | ChEBI |
| metacamphorene | ChEBI |
| m-camphorene | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| 4474914 | ChemSpider |
| HMDB0036853 | HMDB |
| FDB015807 | FooDB |
| C00054830 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:20016-73-3 | NIST Chemistry WebBook |
| Citations |
|---|