EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/C(O)(C(C)C)C3CC3)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C30H46O3/c1-19(2)30(33,24-10-11-24)16-14-20(3)26-12-13-27-22(7-6-15-29(26,27)5)8-9-23-17-25(31)18-28(32)21(23)4/h8-9,14,16,19-20,24-28,31-33H,4,6-7,10-13,15,17-18H2,1-3,5H3/b16-14+,22-8+,23-9-/t20-,25-,26-,27+,28+,29-,30?/m1/s1 |
| InChIKey | KRIFCSVCDLOHLI-TXDSMNBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | intestinal content (NCIT:C189653) | MetaboLights (MTBLS4101) | Strain: C57BL/6JÂ [EFO:0000606] |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,24-Dihydroxy-22-ene-24-cyclopropylvitamin D3 (CHEBI:190320) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R)-5-cyclopropyl-5-hydroxy-6-methylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 24823370 | ChemSpider |
| LMST03020638 | LIPID MAPS |