EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O6 |
| Net Charge | 0 |
| Average Mass | 316.314 |
| Monoisotopic Mass | 316.13828 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CNC(=O)C1OC1C(N)=O)C(=O)O |
| InChI | InChI=1S/C12H20N4O6/c1-4(2)6(12(20)21)16-10(18)5(13)3-15-11(19)8-7(22-8)9(14)17/h4-8H,3,13H2,1-2H3,(H2,14,17)(H,15,19)(H,16,18)(H,20,21)/t5-,6-,7?,8?/m0/s1 |
| InChIKey | HCGFOSJNUODEOH-LHZZQDSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechococcus elongatus PCC 7942 (ncbitaxon:32046) | cell culture (BTO:0000214) | MetaboLights (MTBLS2825) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N(beta)-Epoxysuccinamoyl-diaminopropionyl-valine (CHEBI:190274) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-amino-3-[(3-carbamoyloxirane-2-carbonyl)amino]propanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C20965 | KEGG COMPOUND |