EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H33N5O10 |
| Net Charge | 0 |
| Average Mass | 647.641 |
| Monoisotopic Mass | 647.22274 |
| SMILES | C#CCN(c1ccc(C(=O)N[C@@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O)cc1)[C@H]1CCc2cc3nc(CO)nc(=O)c3cc21 |
| InChI | InChI=1S/C32H33N5O10/c1-2-13-37(25-10-5-18-14-24-21(15-20(18)25)30(43)36-26(16-38)33-24)19-6-3-17(4-7-19)29(42)35-23(32(46)47)8-11-27(39)34-22(31(44)45)9-12-28(40)41/h1,3-4,6-7,14-15,22-23,25,38H,5,8-13,16H2,(H,34,39)(H,35,42)(H,40,41)(H,44,45)(H,46,47)(H,33,36,43)/t22-,23+,25+/m1/s1 |
| InChIKey | NVHRBQOZEMFKLD-CUYJMHBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechococcus elongatus PCC 7942 (ncbitaxon:32046) | cell culture (BTO:0000214) | MetaboLights (MTBLS2825) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BGC 945 (CHEBI:190251) has role antineoplastic agent (CHEBI:35610) |
| BGC 945 (CHEBI:190251) is a glutamic acid derivative (CHEBI:24315) |
| IUPAC Name |
|---|
| (2R)-2-[[(4S)-4-carboxy-4-[[4-[[(6S)-2-(hydroxymethyl)-4-oxo-3,6,7,8-tetrahydrocyclopenta[g]quinazolin-6-yl]-prop-2-ynylamino]benzoyl]amino]butanoyl]amino]pentanedioic acid |
| INN | Source |
|---|---|
| idetrexed | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6S-BGC-945 | ChEMBL |
| BGC-945 | ChEMBL |
| CB-300945 (S) | ChEMBL |
| idetrexed | ChEMBL |
| ONX-0801 | ChEMBL |
| ONX-801 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:501332-69-0 | ChemIDplus |