EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:190244 - Tabtoxin biosynthesis intermediate 3
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | NC(C(=O)O)C(CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c9-4(7(13)14)2-1-3(6(11)12)5(10)8(15)16/h3-5H,1-2,9-10H2,(H,11,12)(H,13,14)(H,15,16)/t3?,4-,5?/m0/s1 |
| InChIKey | PASUXKOQPCAVBI-QHWRUIEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechococcus elongatus PCC 7942 (ncbitaxon:32046) | cell culture (BTO:0000214) | MetaboLights (MTBLS2825) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tabtoxin biosynthesis intermediate 3 (CHEBI:190244) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (5S)-1,5-diaminopentane-1,2,5-tricarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C20913 | KEGG COMPOUND |