EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H76NO10P |
| Net Charge | 0 |
| Average Mass | 774.030 |
| Monoisotopic Mass | 773.52068 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C41H76NO10P/c1-3-5-7-9-11-13-15-17-18-19-21-22-24-26-28-30-32-39(43)49-34-37(35-50-53(47,48)51-36-38(42)41(45)46)52-40(44)33-31-29-27-25-23-20-16-14-12-10-8-6-4-2/h14,16,18-19,37-38H,3-13,15,17,20-36,42H2,1-2H3,(H,45,46)(H,47,48)/b16-14-,19-18-/t37-,38+/m1/s1 |
| InChIKey | JPKMENBYEXXYOZ-BILDVAMGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Canis lupus (ncbitaxon:9612) | liver (BTO:0000759) | MetaboLights (MTBLS4015) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS(17:0/18:2) (CHEBI:190220) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[[(2R)-2-[(Z)-hexadec-9-enoyl]oxy-3-[(Z)-nonadec-9-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113376352 | ChemSpider |
| LMGP03010487 | LIPID MAPS |