EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2 |
| Net Charge | 0 |
| Average Mass | 122.171 |
| Monoisotopic Mass | 122.08440 |
| SMILES | Cc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C7H10N2/c1-5-4-8-6(2)7(3)9-5/h4H,1-3H3 |
| InChIKey | IAEGWXHKWJGQAZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mandragora autumnalis (ncbitaxon:38920) | leaf (BTO:0000713) | PubMed (31390142) | |
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (34827734) | |
| Penaeus vannamei (ncbitaxon:6689) | - | PubMed (34825167) | Species also known as Litopenaeus vannamei. |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethylpyrazine (CHEBI:190131) has role animal metabolite (CHEBI:75767) |
| trimethylpyrazine (CHEBI:190131) has role bacterial metabolite (CHEBI:76969) |
| trimethylpyrazine (CHEBI:190131) has role flavouring agent (CHEBI:35617) |
| trimethylpyrazine (CHEBI:190131) has role pheromone (CHEBI:26013) |
| trimethylpyrazine (CHEBI:190131) has role plant metabolite (CHEBI:76924) |
| trimethylpyrazine (CHEBI:190131) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 2,3,5-trimethylpyrazine |
| Synonyms | Source |
|---|---|
| 2,3,5-trimethyl pyrazine | ChemIDplus |
| 2,3,6-trimethylpyrazine | ChemIDplus |
| FEMA 3244 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031844 | HMDB |
| FDB008527 | FooDB |
| 24972 | ChemSpider |
| 2,3,5-Trimethylpyrazine | Wikipedia |
| C00053868 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2423 | Reaxys |
| CAS:14667-55-1 | ChemIDplus |
| CAS:14667-55-1 | NIST Chemistry WebBook |
| Citations |
|---|