EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O4 |
| Net Charge | 0 |
| Average Mass | 256.262 |
| Monoisotopic Mass | 256.11715 |
| SMILES | CC(O)C(N)C(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O4/c1-5(15)8(11)9(16)14-7(10(17)18)2-6-3-12-4-13-6/h3-5,7-8,15H,2,11H2,1H3,(H,12,13)(H,14,16)(H,17,18) |
| InChIKey | WXVIGTAUZBUDPZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Threoninyl-Histidine (CHEBI:190125) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16568390 | ChemSpider |
| HMDB0029063 | HMDB |