EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42F2O4 |
| Net Charge | 0 |
| Average Mass | 468.625 |
| Monoisotopic Mass | 468.30512 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(F)(F)C(C)(C)O)[C@@]1(C)CCC/C2=C\C1OOCC2=C1C[C@@H](O)CC2 |
| InChI | InChI=1S/C27H42F2O4/c1-17(11-13-27(28,29)25(2,3)31)22-9-10-23-18(6-5-12-26(22,23)4)14-24-21-15-20(30)8-7-19(21)16-32-33-24/h14,17,20,22-24,30-31H,5-13,15-16H2,1-4H3/b18-14+/t17-,20+,22-,23+,24?,26-/m1/s1 |
| InChIKey | ZFWQCKSSHUJFRW-VPTWQCGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6RS)-6,19-epidioxy-24,24-difluoro-25-hydroxy-6,19-dihydrovitamin D3 / (6RS)-6,19-epidioxy-24,24-difluoro-25-hydroxy-6,19-dihydrocholecalciferol (CHEBI:190097) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (6S)-4-[(E)-[(1R,3aS,7aR)-1-[(2R)-5,5-diluoro-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,4,5,6,7,8-hexahydro-2,3-benzodioxin-6-ol |
| Manual Xrefs | Databases |
|---|---|
| 7826330 | ChemSpider |
| LMST03020146 | LIPID MAPS |