EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O15 |
| Net Charge | 0 |
| Average Mass | 606.533 |
| Monoisotopic Mass | 606.15847 |
| SMILES | O=c1c(-c2ccc3c(c2)OCO3)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)C3O)ccc12 |
| InChI | InChI=1S/C28H30O15/c29-7-18-21(32)23(34)24(35)27(41-18)43-26-22(33)19(8-30)42-28(25(26)36)40-12-2-3-13-16(6-12)37-9-14(20(13)31)11-1-4-15-17(5-11)39-10-38-15/h1-6,9,18-19,21-30,32-36H,7-8,10H2/t18?,19?,21-,22-,23+,24?,25?,26+,27+,28-/m1/s1 |
| InChIKey | MVXVJUZTOCOJJR-GVNZUPFMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudobaptigenin 7-O-laminaribioside (CHEBI:190095) is a acrovestone (CHEBI:2440) |
| Pseudobaptigenin 7-O-laminaribioside (CHEBI:190095) is a isoflavonoid (CHEBI:50753) |
| IUPAC Name |
|---|
| 3-(1,3-benzodioxol-5-yl)-7-[(2S,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxychromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| 24842704 | ChemSpider |
| LMPK12050044 | LIPID MAPS |