EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N2O3 |
| Net Charge | 0 |
| Average Mass | 388.552 |
| Monoisotopic Mass | 388.27259 |
| SMILES | [H][C@@]12CC[C@@]3([H])NC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](C(=O)NC(C)(C)CO)CC[C@@]21[H] |
| InChI | InChI=1S/C23H36N2O3/c1-21(2,13-26)25-20(28)17-7-6-15-14-5-8-18-23(4,12-10-19(27)24-18)16(14)9-11-22(15,17)3/h10,12,14-18,26H,5-9,11,13H2,1-4H3,(H,24,27)(H,25,28)/t14-,15-,16-,17+,18+,22-,23+/m0/s1 |
| InChIKey | MFUJYZCMHDCXGQ-WSBQPABSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-Hydroxyfinasteride (CHEBI:190075) has role androgen (CHEBI:50113) |
| o-Hydroxyfinasteride (CHEBI:190075) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-(1-hydroxy-2-methylpropan-2-yl)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-]quinoline-1-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 18612028 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:116285-36-0 | ChemIDplus |