EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO6 |
| Net Charge | 0 |
| Average Mass | 261.274 |
| Monoisotopic Mass | 261.12124 |
| SMILES | CC(C)(CC#N)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3-4-12)18-10-9(16)8(15)7(14)6(5-13)17-10/h6-10,13-16H,3,5H2,1-2H3 |
| InChIKey | GDSYPXWUHMRTHT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Suprofen glucuronide (CHEBI:190074) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| 3-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile |
| Manual Xrefs | Databases |
|---|---|
| 112077 | ChemSpider |
| HMDB0034777 | HMDB |