EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10ClNO2 |
| Net Charge | 0 |
| Average Mass | 223.659 |
| Monoisotopic Mass | 223.04001 |
| SMILES | COC(=O)Cc1cnc2cccc(Cl)c12 |
| InChI | InChI=1S/C11H10ClNO2/c1-15-10(14)5-7-6-13-9-4-2-3-8(12)11(7)9/h2-4,6,13H,5H2,1H3 |
| InChIKey | SYPGJEURLIGNPE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | flower (BTO:0000469) | MetaboLights (MTBLS3950) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 4-chloro-1H-indole-3-acetate (CHEBI:190058) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| methyl 2-(4-chloro-1H-indol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 141665 | ChemSpider |
| HMDB0032937 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:19077-78-2 | ChemIDplus |